C25H18ClN3O3 — CID 75398660
1-benzyl-5-chloro-3-methyl-N-(9-oxoxanthen-2-yl)pyrazole-4-carboxamide (PubChem CID 75398660) has the molecular formula C25H18ClN3O3 and a molecular weight of 443.89 g/mol. Its IUPAC name is 1-benzyl-5-chloro-3-methyl-N-(9-oxoxanthen-2-yl)pyrazole-4-carboxamide.
| Compound Name | 1-benzyl-5-chloro-3-methyl-N-(9-oxoxanthen-2-yl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 75398660 |
| Molecular Formula | C25H18ClN3O3 |
| Molecular Weight | 443.89 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | 1-benzyl-5-chloro-3-methyl-N-(9-oxoxanthen-2-yl)pyrazole-4-carboxamide |
| SMILES | Cc1nn(Cc2ccccc2)c(Cl)c1C(=O)Nc1ccc2oc3ccccc3c(=O)c2c1 |
| InChI | InChI=1S/C25H18ClN3O3/c1-15-22(24(26)29(28-15)14-16-7-3-2-4-8-16)25(31)27-17-11-12-21-19(13-17)23(30)18-9-5-6-10-20(18)32-21/h2-13H,14H2,1H3,(H,27,31) |
| InChIKey | HWEXYEOGCOREHX-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.89 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|