C17H17NO2 — CID 15495610
N-dibenzofuran-3-yl-2,2-dimethylpropanamide (PubChem CID 15495610) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is N-dibenzofuran-3-yl-2,2-dimethylpropanamide.
| Compound Name | N-dibenzofuran-3-yl-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 15495610 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | N-dibenzofuran-3-yl-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1ccc2c(c1)oc1ccccc12 |
| InChI | InChI=1S/C17H17NO2/c1-17(2,3)16(19)18-11-8-9-13-12-6-4-5-7-14(12)20-15(13)10-11/h4-10H,1-3H3,(H,18,19) |
| InChIKey | WMGBYCABAUPEMX-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |