C21H17NO2 — CID 3259661
N-dibenzofuran-3-yl-3,4-dimethylbenzamide (PubChem CID 3259661) has the molecular formula C21H17NO2 and a molecular weight of 315.37 g/mol. Its IUPAC name is N-dibenzofuran-3-yl-3,4-dimethylbenzamide.
| Compound Name | N-dibenzofuran-3-yl-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 3259661 |
| Molecular Formula | C21H17NO2 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | N-dibenzofuran-3-yl-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc3c(c2)oc2ccccc23)cc1C |
| InChI | InChI=1S/C21H17NO2/c1-13-7-8-15(11-14(13)2)21(23)22-16-9-10-18-17-5-3-4-6-19(17)24-20(18)12-16/h3-12H,1-2H3,(H,22,23) |
| InChIKey | QZUQEOZYJXSXRO-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |