C25H19NO3 — CID 3556398
N-dibenzofuran-3-yl-5-(3,4-dimethylphenyl)furan-2-carboxamide (PubChem CID 3556398) has the molecular formula C25H19NO3 and a molecular weight of 381.43 g/mol. Its IUPAC name is N-dibenzofuran-3-yl-5-(3,4-dimethylphenyl)furan-2-carboxamide.
| Compound Name | N-dibenzofuran-3-yl-5-(3,4-dimethylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 3556398 |
| Molecular Formula | C25H19NO3 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | N-dibenzofuran-3-yl-5-(3,4-dimethylphenyl)furan-2-carboxamide |
| SMILES | Cc1ccc(-c2ccc(C(=O)Nc3ccc4c(c3)oc3ccccc34)o2)cc1C |
| InChI | InChI=1S/C25H19NO3/c1-15-7-8-17(13-16(15)2)21-11-12-23(28-21)25(27)26-18-9-10-20-19-5-3-4-6-22(19)29-24(20)14-18/h3-14H,1-2H3,(H,26,27) |
| InChIKey | VTLBEYOZXYMCDX-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 55.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |