C23H25NO2 — CID 3628910
N-(4-butylphenyl)-5-(3,4-dimethylphenyl)furan-2-carboxamide (PubChem CID 3628910) has the molecular formula C23H25NO2 and a molecular weight of 347.46 g/mol. Its IUPAC name is N-(4-butylphenyl)-5-(3,4-dimethylphenyl)furan-2-carboxamide.
| Compound Name | N-(4-butylphenyl)-5-(3,4-dimethylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 3628910 |
| Molecular Formula | C23H25NO2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | N-(4-butylphenyl)-5-(3,4-dimethylphenyl)furan-2-carboxamide |
| SMILES | CCCCc1ccc(NC(=O)c2ccc(-c3ccc(C)c(C)c3)o2)cc1 |
| InChI | InChI=1S/C23H25NO2/c1-4-5-6-18-8-11-20(12-9-18)24-23(25)22-14-13-21(26-22)19-10-7-16(2)17(3)15-19/h7-15H,4-6H2,1-3H3,(H,24,25) |
| InChIKey | MPCJMIHXRWLBKT-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |