C23H19NO2 — CID 4600572
5-(3,4-dimethylphenyl)-N-naphthalen-2-ylfuran-2-carboxamide (PubChem CID 4600572) has the molecular formula C23H19NO2 and a molecular weight of 341.41 g/mol. Its IUPAC name is 5-(3,4-dimethylphenyl)-N-naphthalen-2-ylfuran-2-carboxamide.
| Compound Name | 5-(3,4-dimethylphenyl)-N-naphthalen-2-ylfuran-2-carboxamide |
|---|---|
| PubChem CID | 4600572 |
| Molecular Formula | C23H19NO2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 5-(3,4-dimethylphenyl)-N-naphthalen-2-ylfuran-2-carboxamide |
| SMILES | Cc1ccc(-c2ccc(C(=O)Nc3ccc4ccccc4c3)o2)cc1C |
| InChI | InChI=1S/C23H19NO2/c1-15-7-8-19(13-16(15)2)21-11-12-22(26-21)23(25)24-20-10-9-17-5-3-4-6-18(17)14-20/h3-14H,1-2H3,(H,24,25) |
| InChIKey | GADZJMSELYOWRE-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |