C23H21NO3 — CID 133211026
N-dibenzofuran-3-yl-2-(3,4-dimethylphenoxy)propanamide (PubChem CID 133211026) has the molecular formula C23H21NO3 and a molecular weight of 359.43 g/mol. Its IUPAC name is N-dibenzofuran-3-yl-2-(3,4-dimethylphenoxy)propanamide.
| Compound Name | N-dibenzofuran-3-yl-2-(3,4-dimethylphenoxy)propanamide |
|---|---|
| PubChem CID | 133211026 |
| Molecular Formula | C23H21NO3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | N-dibenzofuran-3-yl-2-(3,4-dimethylphenoxy)propanamide |
| SMILES | Cc1ccc(OC(C)C(=O)Nc2ccc3c(c2)oc2ccccc23)cc1C |
| InChI | InChI=1S/C23H21NO3/c1-14-8-10-18(12-15(14)2)26-16(3)23(25)24-17-9-11-20-19-6-4-5-7-21(19)27-22(20)13-17/h4-13,16H,1-3H3,(H,24,25) |
| InChIKey | JFTWTMVBEVVVHR-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |