C22H19NO3 — CID 133239743
N-dibenzofuran-3-yl-2-(2-methylphenoxy)propanamide (PubChem CID 133239743) has the molecular formula C22H19NO3 and a molecular weight of 345.40 g/mol. Its IUPAC name is N-dibenzofuran-3-yl-2-(2-methylphenoxy)propanamide.
| Compound Name | N-dibenzofuran-3-yl-2-(2-methylphenoxy)propanamide |
|---|---|
| PubChem CID | 133239743 |
| Molecular Formula | C22H19NO3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | N-dibenzofuran-3-yl-2-(2-methylphenoxy)propanamide |
| SMILES | Cc1ccccc1OC(C)C(=O)Nc1ccc2c(c1)oc1ccccc12 |
| InChI | InChI=1S/C22H19NO3/c1-14-7-3-5-9-19(14)25-15(2)22(24)23-16-11-12-18-17-8-4-6-10-20(17)26-21(18)13-16/h3-13,15H,1-2H3,(H,23,24) |
| InChIKey | QKWYNOIROYSTJO-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |