C23H21N3O4 — CID 3378236
3,4,5-trimethoxy-N-(2-phenylimidazo[1,2-a]pyridin-3-yl)benzamide (PubChem CID 3378236) has the molecular formula C23H21N3O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-(2-phenylimidazo[1,2-a]pyridin-3-yl)benzamide.
| Compound Name | 3,4,5-trimethoxy-N-(2-phenylimidazo[1,2-a]pyridin-3-yl)benzamide |
|---|---|
| PubChem CID | 3378236 |
| Molecular Formula | C23H21N3O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 3,4,5-trimethoxy-N-(2-phenylimidazo[1,2-a]pyridin-3-yl)benzamide |
| SMILES | COc1cc(C(=O)Nc2c(-c3ccccc3)nc3ccccn23)cc(OC)c1OC |
| InChI | InChI=1S/C23H21N3O4/c1-28-17-13-16(14-18(29-2)21(17)30-3)23(27)25-22-20(15-9-5-4-6-10-15)24-19-11-7-8-12-26(19)22/h4-14H,1-3H3,(H,25,27) |
| InChIKey | MGRODONYIXPNDV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |