C28H24N4O3S — CID 134050002
3-[ethyl(phenyl)sulfamoyl]-N-(2-phenylimidazo[1,2-a]pyridin-3-yl)benzamide (PubChem CID 134050002) has the molecular formula C28H24N4O3S and a molecular weight of 496.59 g/mol. Its IUPAC name is 3-[ethyl(phenyl)sulfamoyl]-N-(2-phenylimidazo[1,2-a]pyridin-3-yl)benzamide.
| Compound Name | 3-[ethyl(phenyl)sulfamoyl]-N-(2-phenylimidazo[1,2-a]pyridin-3-yl)benzamide |
|---|---|
| PubChem CID | 134050002 |
| Molecular Formula | C28H24N4O3S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | 3-[ethyl(phenyl)sulfamoyl]-N-(2-phenylimidazo[1,2-a]pyridin-3-yl)benzamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1cccc(C(=O)Nc2c(-c3ccccc3)nc3ccccn23)c1 |
| InChI | InChI=1S/C28H24N4O3S/c1-2-32(23-15-7-4-8-16-23)36(34,35)24-17-11-14-22(20-24)28(33)30-27-26(21-12-5-3-6-13-21)29-25-18-9-10-19-31(25)27/h3-20H,2H2,1H3,(H,30,33) |
| InChIKey | FVOWYAXCOXBSNQ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |