C23H20N4O3S2 — CID 55382613
3-[ethyl(phenyl)sulfamoyl]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 55382613) has the molecular formula C23H20N4O3S2 and a molecular weight of 464.57 g/mol. Its IUPAC name is 3-[ethyl(phenyl)sulfamoyl]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 3-[ethyl(phenyl)sulfamoyl]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 55382613 |
| Molecular Formula | C23H20N4O3S2 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | 3-[ethyl(phenyl)sulfamoyl]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1cccc(C(=O)Nc2nnc(-c3ccccc3)s2)c1 |
| InChI | InChI=1S/C23H20N4O3S2/c1-2-27(19-13-7-4-8-14-19)32(29,30)20-15-9-12-18(16-20)21(28)24-23-26-25-22(31-23)17-10-5-3-6-11-17/h3-16H,2H2,1H3,(H,24,26,28) |
| InChIKey | TULFHDSWMGQKTG-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |