C23H21N3O3S2 — CID 38136843
N-(1,3-benzothiazol-2-ylmethyl)-3-[ethyl(phenyl)sulfamoyl]benzamide (PubChem CID 38136843) has the molecular formula C23H21N3O3S2 and a molecular weight of 451.57 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-3-[ethyl(phenyl)sulfamoyl]benzamide.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-3-[ethyl(phenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 38136843 |
| Molecular Formula | C23H21N3O3S2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-3-[ethyl(phenyl)sulfamoyl]benzamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1cccc(C(=O)NCc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C23H21N3O3S2/c1-2-26(18-10-4-3-5-11-18)31(28,29)19-12-8-9-17(15-19)23(27)24-16-22-25-20-13-6-7-14-21(20)30-22/h3-15H,2,16H2,1H3,(H,24,27) |
| InChIKey | WZSCKVGPCOPZDB-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |