C24H22N2O3S — CID 55510278
3-[ethyl(phenyl)sulfamoyl]-N-(3-phenylprop-2-ynyl)benzamide (PubChem CID 55510278) has the molecular formula C24H22N2O3S and a molecular weight of 418.52 g/mol. Its IUPAC name is 3-[ethyl(phenyl)sulfamoyl]-N-(3-phenylprop-2-ynyl)benzamide.
| Compound Name | 3-[ethyl(phenyl)sulfamoyl]-N-(3-phenylprop-2-ynyl)benzamide |
|---|---|
| PubChem CID | 55510278 |
| Molecular Formula | C24H22N2O3S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 3-[ethyl(phenyl)sulfamoyl]-N-(3-phenylprop-2-ynyl)benzamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1cccc(C(=O)NCC#Cc2ccccc2)c1 |
| InChI | InChI=1S/C24H22N2O3S/c1-2-26(22-15-7-4-8-16-22)30(28,29)23-17-9-14-21(19-23)24(27)25-18-10-13-20-11-5-3-6-12-20/h3-9,11-12,14-17,19H,2,18H2,1H3,(H,25,27) |
| InChIKey | HZTCHGMNIZEMNA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|