C21H24N4O4S2 — CID 55492058
N-[2-[3-(1,3-benzothiazol-2-yl)propylamino]-2-oxoethyl]-3-(dimethylsulfamoyl)benzamide (PubChem CID 55492058) has the molecular formula C21H24N4O4S2 and a molecular weight of 460.58 g/mol. Its IUPAC name is N-[2-[3-(1,3-benzothiazol-2-yl)propylamino]-2-oxoethyl]-3-(dimethylsulfamoyl)benzamide.
| Compound Name | N-[2-[3-(1,3-benzothiazol-2-yl)propylamino]-2-oxoethyl]-3-(dimethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55492058 |
| Molecular Formula | C21H24N4O4S2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | N-[2-[3-(1,3-benzothiazol-2-yl)propylamino]-2-oxoethyl]-3-(dimethylsulfamoyl)benzamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(C(=O)NCC(=O)NCCCc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C21H24N4O4S2/c1-25(2)31(28,29)16-8-5-7-15(13-16)21(27)23-14-19(26)22-12-6-11-20-24-17-9-3-4-10-18(17)30-20/h3-5,7-10,13H,6,11-12,14H2,1-2H3,(H,22,26)(H,23,27) |
| InChIKey | ISNXAGUSKRHAKR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|