C11H13N2O5S- — CID 2456562
2-[[3-(dimethylsulfamoyl)benzoyl]amino]acetate (PubChem CID 2456562) has the molecular formula C11H13N2O5S- and a molecular weight of 285.30 g/mol. Its IUPAC name is 2-[[3-(dimethylsulfamoyl)benzoyl]amino]acetate.
| Compound Name | 2-[[3-(dimethylsulfamoyl)benzoyl]amino]acetate |
|---|---|
| PubChem CID | 2456562 |
| Molecular Formula | C11H13N2O5S- |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 2-[[3-(dimethylsulfamoyl)benzoyl]amino]acetate |
| SMILES | CN(C)S(=O)(=O)c1cccc(C(=O)NCC(=O)[O-])c1 |
| InChI | InChI=1S/C11H14N2O5S/c1-13(2)19(17,18)9-5-3-4-8(6-9)11(16)12-7-10(14)15/h3-6H,7H2,1-2H3,(H,12,16)(H,14,15)/p-1 |
| InChIKey | FMVKPAMZUGITEG-UHFFFAOYSA-M |
| XLogP | -1.58 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |