C19H22BrN3O4S — CID 24544650
N-[2-[1-(4-bromophenyl)ethylamino]-2-oxoethyl]-3-(dimethylsulfamoyl)benzamide (PubChem CID 24544650) has the molecular formula C19H22BrN3O4S and a molecular weight of 468.37 g/mol. Its IUPAC name is N-[2-[1-(4-bromophenyl)ethylamino]-2-oxoethyl]-3-(dimethylsulfamoyl)benzamide.
| Compound Name | N-[2-[1-(4-bromophenyl)ethylamino]-2-oxoethyl]-3-(dimethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 24544650 |
| Molecular Formula | C19H22BrN3O4S |
| Molecular Weight | 468.37 g/mol |
| Exact Mass | 467.05 |
| IUPAC Name | N-[2-[1-(4-bromophenyl)ethylamino]-2-oxoethyl]-3-(dimethylsulfamoyl)benzamide |
| SMILES | CC(NC(=O)CNC(=O)c1cccc(S(=O)(=O)N(C)C)c1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H22BrN3O4S/c1-13(14-7-9-16(20)10-8-14)22-18(24)12-21-19(25)15-5-4-6-17(11-15)28(26,27)23(2)3/h4-11,13H,12H2,1-3H3,(H,21,25)(H,22,24) |
| InChIKey | JDQOJKNYJBQYPH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |