C19H18F3N3O3S2 — CID 55520288
N-[3-(1,3-benzothiazol-2-yl)propyl]-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide (PubChem CID 55520288) has the molecular formula C19H18F3N3O3S2 and a molecular weight of 457.50 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)propyl]-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)propyl]-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide |
|---|---|
| PubChem CID | 55520288 |
| Molecular Formula | C19H18F3N3O3S2 |
| Molecular Weight | 457.50 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)propyl]-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide |
| SMILES | O=C(CNS(=O)(=O)c1cccc(C(F)(F)F)c1)NCCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C19H18F3N3O3S2/c20-19(21,22)13-5-3-6-14(11-13)30(27,28)24-12-17(26)23-10-4-9-18-25-15-7-1-2-8-16(15)29-18/h1-3,5-8,11,24H,4,9-10,12H2,(H,23,26) |
| InChIKey | RNNSOXYOKWNCJV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|