C17H15F3N4O3S — CID 112791038
N-(1H-benzimidazol-2-ylmethyl)-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide (PubChem CID 112791038) has the molecular formula C17H15F3N4O3S and a molecular weight of 412.39 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-ylmethyl)-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide.
| Compound Name | N-(1H-benzimidazol-2-ylmethyl)-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide |
|---|---|
| PubChem CID | 112791038 |
| Molecular Formula | C17H15F3N4O3S |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | N-(1H-benzimidazol-2-ylmethyl)-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide |
| SMILES | O=C(CNS(=O)(=O)c1cccc(C(F)(F)F)c1)NCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C17H15F3N4O3S/c18-17(19,20)11-4-3-5-12(8-11)28(26,27)22-10-16(25)21-9-15-23-13-6-1-2-7-14(13)24-15/h1-8,22H,9-10H2,(H,21,25)(H,23,24) |
| InChIKey | FVUGDVBNVFHKBE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |