C18H20F3N3O5S2 — CID 55547144
N-[2-[(4-methylphenyl)sulfonylamino]ethyl]-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide (PubChem CID 55547144) has the molecular formula C18H20F3N3O5S2 and a molecular weight of 479.50 g/mol. Its IUPAC name is N-[2-[(4-methylphenyl)sulfonylamino]ethyl]-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide.
| Compound Name | N-[2-[(4-methylphenyl)sulfonylamino]ethyl]-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide |
|---|---|
| PubChem CID | 55547144 |
| Molecular Formula | C18H20F3N3O5S2 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | N-[2-[(4-methylphenyl)sulfonylamino]ethyl]-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCNC(=O)CNS(=O)(=O)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C18H20F3N3O5S2/c1-13-5-7-15(8-6-13)30(26,27)23-10-9-22-17(25)12-24-31(28,29)16-4-2-3-14(11-16)18(19,20)21/h2-8,11,23-24H,9-10,12H2,1H3,(H,22,25) |
| InChIKey | HAPQNQGQZZYXHC-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|