C19H21F3N2O4S — CID 56548668
N-[3-(4-methoxyphenyl)propyl]-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide (PubChem CID 56548668) has the molecular formula C19H21F3N2O4S and a molecular weight of 430.45 g/mol. Its IUPAC name is N-[3-(4-methoxyphenyl)propyl]-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide.
| Compound Name | N-[3-(4-methoxyphenyl)propyl]-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide |
|---|---|
| PubChem CID | 56548668 |
| Molecular Formula | C19H21F3N2O4S |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | N-[3-(4-methoxyphenyl)propyl]-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide |
| SMILES | COc1ccc(CCCNC(=O)CNS(=O)(=O)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C19H21F3N2O4S/c1-28-16-9-7-14(8-10-16)4-3-11-23-18(25)13-24-29(26,27)17-6-2-5-15(12-17)19(20,21)22/h2,5-10,12,24H,3-4,11,13H2,1H3,(H,23,25) |
| InChIKey | JOWJTPUKMUNZAP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|