C23H20N4O3S3 — CID 2114843
N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-3-[methyl(phenyl)sulfamoyl]benzamide (PubChem CID 2114843) has the molecular formula C23H20N4O3S3 and a molecular weight of 496.64 g/mol. Its IUPAC name is N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-3-[methyl(phenyl)sulfamoyl]benzamide.
| Compound Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-3-[methyl(phenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 2114843 |
| Molecular Formula | C23H20N4O3S3 |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.07 |
| IUPAC Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-3-[methyl(phenyl)sulfamoyl]benzamide |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1cccc(C(=O)Nc2nnc(SCc3ccccc3)s2)c1 |
| InChI | InChI=1S/C23H20N4O3S3/c1-27(19-12-6-3-7-13-19)33(29,30)20-14-8-11-18(15-20)21(28)24-22-25-26-23(32-22)31-16-17-9-4-2-5-10-17/h2-15H,16H2,1H3,(H,24,25,28) |
| InChIKey | XYCMKTBIVLNRCD-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|