C18H17ClN4O3S3 — CID 100646698
N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-chloro-4-[methyl(methylsulfonyl)amino]benzamide (PubChem CID 100646698) has the molecular formula C18H17ClN4O3S3 and a molecular weight of 469.01 g/mol. Its IUPAC name is N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-chloro-4-[methyl(methylsulfonyl)amino]benzamide.
| Compound Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-chloro-4-[methyl(methylsulfonyl)amino]benzamide |
|---|---|
| PubChem CID | 100646698 |
| Molecular Formula | C18H17ClN4O3S3 |
| Molecular Weight | 469.01 g/mol |
| Exact Mass | 468.02 |
| IUPAC Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-chloro-4-[methyl(methylsulfonyl)amino]benzamide |
| SMILES | CN(c1ccc(C(=O)Nc2nnc(SCc3ccccc3)s2)c(Cl)c1)S(C)(=O)=O |
| InChI | InChI=1S/C18H17ClN4O3S3/c1-23(29(2,25)26)13-8-9-14(15(19)10-13)16(24)20-17-21-22-18(28-17)27-11-12-6-4-3-5-7-12/h3-10H,11H2,1-2H3,(H,20,21,24) |
| InChIKey | XRMLKTSVTRMQEO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.01 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|