C21H17N3O — CID 965390
2-methyl-N-(2-phenylimidazo[1,2-a]pyridin-3-yl)benzamide (PubChem CID 965390) has the molecular formula C21H17N3O and a molecular weight of 327.39 g/mol. Its IUPAC name is 2-methyl-N-(2-phenylimidazo[1,2-a]pyridin-3-yl)benzamide.
| Compound Name | 2-methyl-N-(2-phenylimidazo[1,2-a]pyridin-3-yl)benzamide |
|---|---|
| PubChem CID | 965390 |
| Molecular Formula | C21H17N3O |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 2-methyl-N-(2-phenylimidazo[1,2-a]pyridin-3-yl)benzamide |
| SMILES | Cc1ccccc1C(=O)Nc1c(-c2ccccc2)nc2ccccn12 |
| InChI | InChI=1S/C21H17N3O/c1-15-9-5-6-12-17(15)21(25)23-20-19(16-10-3-2-4-11-16)22-18-13-7-8-14-24(18)20/h2-14H,1H3,(H,23,25) |
| InChIKey | BZSMXUZWSUEJFJ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |