C20H13FIN3O — CID 55686583
4-fluoro-2-iodo-N-(2-phenylimidazo[1,2-a]pyridin-3-yl)benzamide (PubChem CID 55686583) has the molecular formula C20H13FIN3O and a molecular weight of 457.25 g/mol. Its IUPAC name is 4-fluoro-2-iodo-N-(2-phenylimidazo[1,2-a]pyridin-3-yl)benzamide.
| Compound Name | 4-fluoro-2-iodo-N-(2-phenylimidazo[1,2-a]pyridin-3-yl)benzamide |
|---|---|
| PubChem CID | 55686583 |
| Molecular Formula | C20H13FIN3O |
| Molecular Weight | 457.25 g/mol |
| Exact Mass | 457.01 |
| IUPAC Name | 4-fluoro-2-iodo-N-(2-phenylimidazo[1,2-a]pyridin-3-yl)benzamide |
| SMILES | O=C(Nc1c(-c2ccccc2)nc2ccccn12)c1ccc(F)cc1I |
| InChI | InChI=1S/C20H13FIN3O/c21-14-9-10-15(16(22)12-14)20(26)24-19-18(13-6-2-1-3-7-13)23-17-8-4-5-11-25(17)19/h1-12H,(H,24,26) |
| InChIKey | DJJKSPHOKXEPRI-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.25 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|