C24H17N5O2 — CID 167849699
2-oxo-6-phenyl-N-(2-pyridin-2-ylimidazo[1,2-a]pyridin-3-yl)-1H-pyridine-3-carboxamide (PubChem CID 167849699) has the molecular formula C24H17N5O2 and a molecular weight of 407.43 g/mol. Its IUPAC name is 2-oxo-6-phenyl-N-(2-pyridin-2-ylimidazo[1,2-a]pyridin-3-yl)-1H-pyridine-3-carboxamide.
| Compound Name | 2-oxo-6-phenyl-N-(2-pyridin-2-ylimidazo[1,2-a]pyridin-3-yl)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 167849699 |
| Molecular Formula | C24H17N5O2 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 2-oxo-6-phenyl-N-(2-pyridin-2-ylimidazo[1,2-a]pyridin-3-yl)-1H-pyridine-3-carboxamide |
| SMILES | O=C(Nc1c(-c2ccccn2)nc2ccccn12)c1ccc(-c2ccccc2)[nH]c1=O |
| InChI | InChI=1S/C24H17N5O2/c30-23-17(12-13-18(26-23)16-8-2-1-3-9-16)24(31)28-22-21(19-10-4-6-14-25-19)27-20-11-5-7-15-29(20)22/h1-15H,(H,26,30)(H,28,31) |
| InChIKey | PALGMTMMMHAMIH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_65_Db(5)', 'substructure': 'N/A'} |
|---|