C22H20N4O — CID 50847541
1-(3,4-dimethylphenyl)-3-(2-phenylimidazo[1,2-a]pyridin-3-yl)urea (PubChem CID 50847541) has the molecular formula C22H20N4O and a molecular weight of 356.43 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-(2-phenylimidazo[1,2-a]pyridin-3-yl)urea.
| Compound Name | 1-(3,4-dimethylphenyl)-3-(2-phenylimidazo[1,2-a]pyridin-3-yl)urea |
|---|---|
| PubChem CID | 50847541 |
| Molecular Formula | C22H20N4O |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-(2-phenylimidazo[1,2-a]pyridin-3-yl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2c(-c3ccccc3)nc3ccccn23)cc1C |
| InChI | InChI=1S/C22H20N4O/c1-15-11-12-18(14-16(15)2)23-22(27)25-21-20(17-8-4-3-5-9-17)24-19-10-6-7-13-26(19)21/h3-14H,1-2H3,(H2,23,25,27) |
| InChIKey | OYCCRMDNTNVFIY-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |