C20H22N4O — CID 50847510
1-cyclopentyl-3-[2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]urea (PubChem CID 50847510) has the molecular formula C20H22N4O and a molecular weight of 334.42 g/mol. Its IUPAC name is 1-cyclopentyl-3-[2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]urea.
| Compound Name | 1-cyclopentyl-3-[2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]urea |
|---|---|
| PubChem CID | 50847510 |
| Molecular Formula | C20H22N4O |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 1-cyclopentyl-3-[2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]urea |
| SMILES | Cc1ccc(-c2nc3ccccn3c2NC(=O)NC2CCCC2)cc1 |
| InChI | InChI=1S/C20H22N4O/c1-14-9-11-15(12-10-14)18-19(24-13-5-4-8-17(24)22-18)23-20(25)21-16-6-2-3-7-16/h4-5,8-13,16H,2-3,6-7H2,1H3,(H2,21,23,25) |
| InChIKey | MMXZBFLTZVKWGH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |