C23H21N3O3S — CID 43034625
3,4-dimethoxy-N-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)-5-prop-2-enylbenzamide (PubChem CID 43034625) has the molecular formula C23H21N3O3S and a molecular weight of 419.51 g/mol. Its IUPAC name is 3,4-dimethoxy-N-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)-5-prop-2-enylbenzamide.
| Compound Name | 3,4-dimethoxy-N-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)-5-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 43034625 |
| Molecular Formula | C23H21N3O3S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 3,4-dimethoxy-N-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)-5-prop-2-enylbenzamide |
| SMILES | C=CCc1cc(C(=O)Nc2c(-c3ccccc3)nc3sccn23)cc(OC)c1OC |
| InChI | InChI=1S/C23H21N3O3S/c1-4-8-16-13-17(14-18(28-2)20(16)29-3)22(27)25-21-19(15-9-6-5-7-10-15)24-23-26(21)11-12-30-23/h4-7,9-14H,1,8H2,2-3H3,(H,25,27) |
| InChIKey | FCWZUYFSIWWZSM-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|