C23H20N4O2 — CID 177415618
2-(dibenzylamino)-3-[(E)-hydroxyiminomethyl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 177415618) has the molecular formula C23H20N4O2 and a molecular weight of 384.44 g/mol. Its IUPAC name is 2-(dibenzylamino)-3-[(E)-hydroxyiminomethyl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-(dibenzylamino)-3-[(E)-hydroxyiminomethyl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 177415618 |
| Molecular Formula | C23H20N4O2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 2-(dibenzylamino)-3-[(E)-hydroxyiminomethyl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1c(/C=N/O)c(N(Cc2ccccc2)Cc2ccccc2)nc2ccccn12 |
| InChI | InChI=1S/C23H20N4O2/c28-23-20(15-24-29)22(25-21-13-7-8-14-27(21)23)26(16-18-9-3-1-4-10-18)17-19-11-5-2-6-12-19/h1-15,29H,16-17H2/b24-15+ |
| InChIKey | XKXMUHVMPGKFRF-BUVRLJJBSA-N |
| XLogP | 3.71 |
| TPSA | 70.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|