C25H21N3O2 — CID 134876651
4-oxo-2-(N-[(E)-4-phenylbut-2-enyl]anilino)pyrido[1,2-a]pyrimidine-3-carbaldehyde (PubChem CID 134876651) has the molecular formula C25H21N3O2 and a molecular weight of 395.46 g/mol. Its IUPAC name is 4-oxo-2-(N-[(E)-4-phenylbut-2-enyl]anilino)pyrido[1,2-a]pyrimidine-3-carbaldehyde.
| Compound Name | 4-oxo-2-(N-[(E)-4-phenylbut-2-enyl]anilino)pyrido[1,2-a]pyrimidine-3-carbaldehyde |
|---|---|
| PubChem CID | 134876651 |
| Molecular Formula | C25H21N3O2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 4-oxo-2-(N-[(E)-4-phenylbut-2-enyl]anilino)pyrido[1,2-a]pyrimidine-3-carbaldehyde |
| SMILES | O=Cc1c(N(C/C=C/Cc2ccccc2)c2ccccc2)nc2ccccn2c1=O |
| InChI | InChI=1S/C25H21N3O2/c29-19-22-24(26-23-16-8-10-18-28(23)25(22)30)27(21-14-5-2-6-15-21)17-9-7-13-20-11-3-1-4-12-20/h1-12,14-16,18-19H,13,17H2/b9-7+ |
| InChIKey | ADCZSIXJQYXPQM-VQHVLOKHSA-N |
| XLogP | 4.44 |
| TPSA | 54.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|