C18H18N4O3 — CID 133383863
2-[benzyl(propyl)amino]-3-nitropyrido[1,2-a]pyrimidin-4-one (PubChem CID 133383863) has the molecular formula C18H18N4O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is 2-[benzyl(propyl)amino]-3-nitropyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[benzyl(propyl)amino]-3-nitropyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 133383863 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 2-[benzyl(propyl)amino]-3-nitropyrido[1,2-a]pyrimidin-4-one |
| SMILES | CCCN(Cc1ccccc1)c1nc2ccccn2c(=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H18N4O3/c1-2-11-20(13-14-8-4-3-5-9-14)17-16(22(24)25)18(23)21-12-7-6-10-15(21)19-17/h3-10,12H,2,11,13H2,1H3 |
| InChIKey | SLVZWSWSRFZWIP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|