C14H11N5O3 — CID 46633325
3-nitro-2-(pyridin-3-ylmethylamino)pyrido[1,2-a]pyrimidin-4-one (PubChem CID 46633325) has the molecular formula C14H11N5O3 and a molecular weight of 297.27 g/mol. Its IUPAC name is 3-nitro-2-(pyridin-3-ylmethylamino)pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-nitro-2-(pyridin-3-ylmethylamino)pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 46633325 |
| Molecular Formula | C14H11N5O3 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 3-nitro-2-(pyridin-3-ylmethylamino)pyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1c([N+](=O)[O-])c(NCc2cccnc2)nc2ccccn12 |
| InChI | InChI=1S/C14H11N5O3/c20-14-12(19(21)22)13(16-9-10-4-3-6-15-8-10)17-11-5-1-2-7-18(11)14/h1-8,16H,9H2 |
| InChIKey | PCMQCIHMZTZHQX-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|