C13H8N4O4 — CID 42943726
3-nitro-2-pyridin-3-yloxypyrido[1,2-a]pyrimidin-4-one (PubChem CID 42943726) has the molecular formula C13H8N4O4 and a molecular weight of 284.23 g/mol. Its IUPAC name is 3-nitro-2-pyridin-3-yloxypyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-nitro-2-pyridin-3-yloxypyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 42943726 |
| Molecular Formula | C13H8N4O4 |
| Molecular Weight | 284.23 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 3-nitro-2-pyridin-3-yloxypyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1c([N+](=O)[O-])c(Oc2cccnc2)nc2ccccn12 |
| InChI | InChI=1S/C13H8N4O4/c18-13-11(17(19)20)12(21-9-4-3-6-14-8-9)15-10-5-1-2-7-16(10)13/h1-8H |
| InChIKey | ATURRAXSRVUZBV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 99.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.23 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|