C16H22N6O3 — CID 94751490
2-[[(2S)-2-(4-methylpiperazin-1-yl)propyl]amino]-3-nitropyrido[1,2-a]pyrimidin-4-one (PubChem CID 94751490) has the molecular formula C16H22N6O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is 2-[[(2S)-2-(4-methylpiperazin-1-yl)propyl]amino]-3-nitropyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[[(2S)-2-(4-methylpiperazin-1-yl)propyl]amino]-3-nitropyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 94751490 |
| Molecular Formula | C16H22N6O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 2-[[(2S)-2-(4-methylpiperazin-1-yl)propyl]amino]-3-nitropyrido[1,2-a]pyrimidin-4-one |
| SMILES | C[C@@H](CNc1nc2ccccn2c(=O)c1[N+](=O)[O-])N1CCN(C)CC1 |
| InChI | InChI=1S/C16H22N6O3/c1-12(20-9-7-19(2)8-10-20)11-17-15-14(22(24)25)16(23)21-6-4-3-5-13(21)18-15/h3-6,12,17H,7-11H2,1-2H3/t12-/m0/s1 |
| InChIKey | DARBXTRTWPZBPT-LBPRGKRZSA-N |
| XLogP | 0.65 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|