C14H15N5O4 — CID 46531732
3-nitro-2-[(2-oxo-2-pyrrolidin-1-ylethyl)amino]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 46531732) has the molecular formula C14H15N5O4 and a molecular weight of 317.30 g/mol. Its IUPAC name is 3-nitro-2-[(2-oxo-2-pyrrolidin-1-ylethyl)amino]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-nitro-2-[(2-oxo-2-pyrrolidin-1-ylethyl)amino]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 46531732 |
| Molecular Formula | C14H15N5O4 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 3-nitro-2-[(2-oxo-2-pyrrolidin-1-ylethyl)amino]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=C(CNc1nc2ccccn2c(=O)c1[N+](=O)[O-])N1CCCC1 |
| InChI | InChI=1S/C14H15N5O4/c20-11(17-6-3-4-7-17)9-15-13-12(19(22)23)14(21)18-8-2-1-5-10(18)16-13/h1-2,5,8,15H,3-4,6-7,9H2 |
| InChIKey | XXGAZCQMPGCYLJ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|