C14H15N5O6S — CID 93233621
N-[(3S)-1,1-dioxothiolan-3-yl]-2-[(3-nitro-4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]acetamide (PubChem CID 93233621) has the molecular formula C14H15N5O6S and a molecular weight of 381.37 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-2-[(3-nitro-4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]acetamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-[(3-nitro-4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]acetamide |
|---|---|
| PubChem CID | 93233621 |
| Molecular Formula | C14H15N5O6S |
| Molecular Weight | 381.37 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-[(3-nitro-4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]acetamide |
| SMILES | O=C(CNc1nc2ccccn2c(=O)c1[N+](=O)[O-])N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H15N5O6S/c20-11(16-9-4-6-26(24,25)8-9)7-15-13-12(19(22)23)14(21)18-5-2-1-3-10(18)17-13/h1-3,5,9,15H,4,6-8H2,(H,16,20)/t9-/m0/s1 |
| InChIKey | RDABXJOXKPTTDD-VIFPVBQESA-N |
| XLogP | -0.68 |
| TPSA | 152.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.37 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|