C18H14N6O3 — CID 55729028
3-nitro-2-[[4-(1H-pyrazol-5-yl)phenyl]methylamino]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 55729028) has the molecular formula C18H14N6O3 and a molecular weight of 362.35 g/mol. Its IUPAC name is 3-nitro-2-[[4-(1H-pyrazol-5-yl)phenyl]methylamino]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-nitro-2-[[4-(1H-pyrazol-5-yl)phenyl]methylamino]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 55729028 |
| Molecular Formula | C18H14N6O3 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 3-nitro-2-[[4-(1H-pyrazol-5-yl)phenyl]methylamino]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1c([N+](=O)[O-])c(NCc2ccc(-c3ccn[nH]3)cc2)nc2ccccn12 |
| InChI | InChI=1S/C18H14N6O3/c25-18-16(24(26)27)17(21-15-3-1-2-10-23(15)18)19-11-12-4-6-13(7-5-12)14-8-9-20-22-14/h1-10,19H,11H2,(H,20,22) |
| InChIKey | MMYKHJAPPXLGLW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|