C11H9N7O4 — CID 137271845
3-nitro-2-[(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)methylamino]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 137271845) has the molecular formula C11H9N7O4 and a molecular weight of 303.24 g/mol. Its IUPAC name is 3-nitro-2-[(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)methylamino]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-nitro-2-[(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)methylamino]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 137271845 |
| Molecular Formula | C11H9N7O4 |
| Molecular Weight | 303.24 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 3-nitro-2-[(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)methylamino]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1[nH]nc(CNc2nc3ccccn3c(=O)c2[N+](=O)[O-])[nH]1 |
| InChI | InChI=1S/C11H9N7O4/c19-10-8(18(21)22)9(12-5-6-13-11(20)16-15-6)14-7-3-1-2-4-17(7)10/h1-4,12H,5H2,(H2,13,15,16,20) |
| InChIKey | IUNUZQUDMFMHHG-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 151.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.24 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|