C17H22N4O4 — CID 97070706
2-[[(2S,3S)-2-tert-butyloxolan-3-yl]methylamino]-3-nitropyrido[1,2-a]pyrimidin-4-one (PubChem CID 97070706) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is 2-[[(2S,3S)-2-tert-butyloxolan-3-yl]methylamino]-3-nitropyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[[(2S,3S)-2-tert-butyloxolan-3-yl]methylamino]-3-nitropyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 97070706 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 2-[[(2S,3S)-2-tert-butyloxolan-3-yl]methylamino]-3-nitropyrido[1,2-a]pyrimidin-4-one |
| SMILES | CC(C)(C)[C@H]1OCC[C@H]1CNc1nc2ccccn2c(=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H22N4O4/c1-17(2,3)14-11(7-9-25-14)10-18-15-13(21(23)24)16(22)20-8-5-4-6-12(20)19-15/h4-6,8,11,14,18H,7,9-10H2,1-3H3/t11-,14-/m0/s1 |
| InChIKey | KHQRUCINOLGXMC-FZMZJTMJSA-N |
| XLogP | 2.47 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|