C18H16N4O3 — CID 92845226
2-[[(R)-cyclopropyl(phenyl)methyl]amino]-3-nitropyrido[1,2-a]pyrimidin-4-one (PubChem CID 92845226) has the molecular formula C18H16N4O3 and a molecular weight of 336.35 g/mol. Its IUPAC name is 2-[[(R)-cyclopropyl(phenyl)methyl]amino]-3-nitropyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[[(R)-cyclopropyl(phenyl)methyl]amino]-3-nitropyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 92845226 |
| Molecular Formula | C18H16N4O3 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 2-[[(R)-cyclopropyl(phenyl)methyl]amino]-3-nitropyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1c([N+](=O)[O-])c(N[C@@H](c2ccccc2)C2CC2)nc2ccccn12 |
| InChI | InChI=1S/C18H16N4O3/c23-18-16(22(24)25)17(19-14-8-4-5-11-21(14)18)20-15(13-9-10-13)12-6-2-1-3-7-12/h1-8,11,13,15,20H,9-10H2/t15-/m0/s1 |
| InChIKey | CIVBSLWQCUUTPC-HNNXBMFYSA-N |
| XLogP | 3.17 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|