C15H18N4O3 — CID 133333249
2-(2,5-dimethylpiperidin-1-yl)-3-nitropyrido[1,2-a]pyrimidin-4-one (PubChem CID 133333249) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is 2-(2,5-dimethylpiperidin-1-yl)-3-nitropyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-(2,5-dimethylpiperidin-1-yl)-3-nitropyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 133333249 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 2-(2,5-dimethylpiperidin-1-yl)-3-nitropyrido[1,2-a]pyrimidin-4-one |
| SMILES | CC1CCC(C)N(c2nc3ccccn3c(=O)c2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C15H18N4O3/c1-10-6-7-11(2)18(9-10)14-13(19(21)22)15(20)17-8-4-3-5-12(17)16-14/h3-5,8,10-11H,6-7,9H2,1-2H3 |
| InChIKey | ADTJNEFBKGFSEV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|