C16H17N7O3 — CID 92856330
2-[(3S)-3-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]-3-nitropyrido[1,2-a]pyrimidin-4-one (PubChem CID 92856330) has the molecular formula C16H17N7O3 and a molecular weight of 355.36 g/mol. Its IUPAC name is 2-[(3S)-3-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]-3-nitropyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[(3S)-3-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]-3-nitropyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 92856330 |
| Molecular Formula | C16H17N7O3 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 2-[(3S)-3-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]-3-nitropyrido[1,2-a]pyrimidin-4-one |
| SMILES | Cn1cnnc1[C@H]1CCCN(c2nc3ccccn3c(=O)c2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C16H17N7O3/c1-20-10-17-19-14(20)11-5-4-7-21(9-11)15-13(23(25)26)16(24)22-8-3-2-6-12(22)18-15/h2-3,6,8,10-11H,4-5,7,9H2,1H3/t11-/m0/s1 |
| InChIKey | NDPHKNUEQBXGTP-NSHDSACASA-N |
| XLogP | 1.12 |
| TPSA | 111.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|