C22H31N5O5 — CID 55825603
tert-butyl N-[[1-(3-nitro-4-oxopyrido[1,2-a]pyrimidin-2-yl)piperidin-3-yl]methyl]-N-propan-2-ylcarbamate (PubChem CID 55825603) has the molecular formula C22H31N5O5 and a molecular weight of 445.52 g/mol. Its IUPAC name is tert-butyl N-[[1-(3-nitro-4-oxopyrido[1,2-a]pyrimidin-2-yl)piperidin-3-yl]methyl]-N-propan-2-ylcarbamate.
| Compound Name | tert-butyl N-[[1-(3-nitro-4-oxopyrido[1,2-a]pyrimidin-2-yl)piperidin-3-yl]methyl]-N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 55825603 |
| Molecular Formula | C22H31N5O5 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | tert-butyl N-[[1-(3-nitro-4-oxopyrido[1,2-a]pyrimidin-2-yl)piperidin-3-yl]methyl]-N-propan-2-ylcarbamate |
| SMILES | CC(C)N(CC1CCCN(c2nc3ccccn3c(=O)c2[N+](=O)[O-])C1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H31N5O5/c1-15(2)26(21(29)32-22(3,4)5)14-16-9-8-11-24(13-16)19-18(27(30)31)20(28)25-12-7-6-10-17(25)23-19/h6-7,10,12,15-16H,8-9,11,13-14H2,1-5H3 |
| InChIKey | QOTHWKJDLMJAML-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|