C22H34N4O5 — CID 55826384
tert-butyl N-[[1-[2-(2-nitroanilino)-2-oxoethyl]piperidin-3-yl]methyl]-N-propan-2-ylcarbamate (PubChem CID 55826384) has the molecular formula C22H34N4O5 and a molecular weight of 434.54 g/mol. Its IUPAC name is tert-butyl N-[[1-[2-(2-nitroanilino)-2-oxoethyl]piperidin-3-yl]methyl]-N-propan-2-ylcarbamate.
| Compound Name | tert-butyl N-[[1-[2-(2-nitroanilino)-2-oxoethyl]piperidin-3-yl]methyl]-N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 55826384 |
| Molecular Formula | C22H34N4O5 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | tert-butyl N-[[1-[2-(2-nitroanilino)-2-oxoethyl]piperidin-3-yl]methyl]-N-propan-2-ylcarbamate |
| SMILES | CC(C)N(CC1CCCN(CC(=O)Nc2ccccc2[N+](=O)[O-])C1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H34N4O5/c1-16(2)25(21(28)31-22(3,4)5)14-17-9-8-12-24(13-17)15-20(27)23-18-10-6-7-11-19(18)26(29)30/h6-7,10-11,16-17H,8-9,12-15H2,1-5H3,(H,23,27) |
| InChIKey | AHPPCYOMBIYZLI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|