C22H32N4O3 — CID 56526436
tert-butyl N-[[1-[3-(2-cyanoanilino)-3-oxopropyl]piperidin-3-yl]methyl]-N-methylcarbamate (PubChem CID 56526436) has the molecular formula C22H32N4O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is tert-butyl N-[[1-[3-(2-cyanoanilino)-3-oxopropyl]piperidin-3-yl]methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[[1-[3-(2-cyanoanilino)-3-oxopropyl]piperidin-3-yl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 56526436 |
| Molecular Formula | C22H32N4O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | tert-butyl N-[[1-[3-(2-cyanoanilino)-3-oxopropyl]piperidin-3-yl]methyl]-N-methylcarbamate |
| SMILES | CN(CC1CCCN(CCC(=O)Nc2ccccc2C#N)C1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H32N4O3/c1-22(2,3)29-21(28)25(4)15-17-8-7-12-26(16-17)13-11-20(27)24-19-10-6-5-9-18(19)14-23/h5-6,9-10,17H,7-8,11-13,15-16H2,1-4H3,(H,24,27) |
| InChIKey | BXMALFPLPDKGRK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |