C21H34N2O3 — CID 145297046
tert-butyl N-[[1-[2-(3-methoxyphenyl)ethyl]piperidin-3-yl]methyl]-N-methylcarbamate (PubChem CID 145297046) has the molecular formula C21H34N2O3 and a molecular weight of 362.51 g/mol. Its IUPAC name is tert-butyl N-[[1-[2-(3-methoxyphenyl)ethyl]piperidin-3-yl]methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[[1-[2-(3-methoxyphenyl)ethyl]piperidin-3-yl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 145297046 |
| Molecular Formula | C21H34N2O3 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | tert-butyl N-[[1-[2-(3-methoxyphenyl)ethyl]piperidin-3-yl]methyl]-N-methylcarbamate |
| SMILES | COc1cccc(CCN2CCCC(CN(C)C(=O)OC(C)(C)C)C2)c1 |
| InChI | InChI=1S/C21H34N2O3/c1-21(2,3)26-20(24)22(4)15-18-9-7-12-23(16-18)13-11-17-8-6-10-19(14-17)25-5/h6,8,10,14,18H,7,9,11-13,15-16H2,1-5H3 |
| InChIKey | PSNXDTYXBCANPZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |