C17H20N4O — CID 53353889
2-(cyclopropylmethylamino)-3-(cyclopropylmethyliminomethyl)pyrido[1,2-a]pyrimidin-4-one (PubChem CID 53353889) has the molecular formula C17H20N4O and a molecular weight of 296.37 g/mol. Its IUPAC name is 2-(cyclopropylmethylamino)-3-(cyclopropylmethyliminomethyl)pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-(cyclopropylmethylamino)-3-(cyclopropylmethyliminomethyl)pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 53353889 |
| Molecular Formula | C17H20N4O |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 2-(cyclopropylmethylamino)-3-(cyclopropylmethyliminomethyl)pyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1c(/C=N/CC2CC2)c(NCC2CC2)nc2ccccn12 |
| InChI | InChI=1S/C17H20N4O/c22-17-14(11-18-9-12-4-5-12)16(19-10-13-6-7-13)20-15-3-1-2-8-21(15)17/h1-3,8,11-13,19H,4-7,9-10H2/b18-11+ |
| InChIKey | QTYOGXUCUUOSOQ-WOJGMQOQSA-N |
| XLogP | 2.35 |
| TPSA | 58.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|