C25H24N4O3 — CID 1159853
2-(4-ethoxyanilino)-3-[(4-ethoxyphenyl)iminomethyl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 1159853) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is 2-(4-ethoxyanilino)-3-[(4-ethoxyphenyl)iminomethyl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-(4-ethoxyanilino)-3-[(4-ethoxyphenyl)iminomethyl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 1159853 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 2-(4-ethoxyanilino)-3-[(4-ethoxyphenyl)iminomethyl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | CCOc1ccc(/N=C/c2c(Nc3ccc(OCC)cc3)nc3ccccn3c2=O)cc1 |
| InChI | InChI=1S/C25H24N4O3/c1-3-31-20-12-8-18(9-13-20)26-17-22-24(27-19-10-14-21(15-11-19)32-4-2)28-23-7-5-6-16-29(23)25(22)30/h5-17,27H,3-4H2,1-2H3/b26-17+ |
| InChIKey | HKWPVPLLAZDZKA-YZSQISJMSA-N |
| XLogP | 4.99 |
| TPSA | 77.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|