C25H22N2O3 — CID 4139047
2-benzyl-4-[(4-ethoxyphenyl)iminomethyl]-3-hydroxyisoquinolin-1-one (PubChem CID 4139047) has the molecular formula C25H22N2O3 and a molecular weight of 398.46 g/mol. Its IUPAC name is 2-benzyl-4-[(4-ethoxyphenyl)iminomethyl]-3-hydroxyisoquinolin-1-one.
| Compound Name | 2-benzyl-4-[(4-ethoxyphenyl)iminomethyl]-3-hydroxyisoquinolin-1-one |
|---|---|
| PubChem CID | 4139047 |
| Molecular Formula | C25H22N2O3 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 2-benzyl-4-[(4-ethoxyphenyl)iminomethyl]-3-hydroxyisoquinolin-1-one |
| SMILES | CCOc1ccc(/N=C/c2c(O)n(Cc3ccccc3)c(=O)c3ccccc23)cc1 |
| InChI | InChI=1S/C25H22N2O3/c1-2-30-20-14-12-19(13-15-20)26-16-23-21-10-6-7-11-22(21)24(28)27(25(23)29)17-18-8-4-3-5-9-18/h3-16,29H,2,17H2,1H3/b26-16+ |
| InChIKey | KNQIILJRJKNETL-WGOQTCKBSA-N |
| XLogP | 4.90 |
| TPSA | 63.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|