C30H33N3O3 — CID 135931048
4-[[2-(diethylamino)-2-phenylethyl]iminomethyl]-3-hydroxy-2-[(4-methoxyphenyl)methyl]isoquinolin-1-one (PubChem CID 135931048) has the molecular formula C30H33N3O3 and a molecular weight of 483.61 g/mol. Its IUPAC name is 4-[[2-(diethylamino)-2-phenylethyl]iminomethyl]-3-hydroxy-2-[(4-methoxyphenyl)methyl]isoquinolin-1-one.
| Compound Name | 4-[[2-(diethylamino)-2-phenylethyl]iminomethyl]-3-hydroxy-2-[(4-methoxyphenyl)methyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 135931048 |
| Molecular Formula | C30H33N3O3 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | 4-[[2-(diethylamino)-2-phenylethyl]iminomethyl]-3-hydroxy-2-[(4-methoxyphenyl)methyl]isoquinolin-1-one |
| SMILES | CCN(CC)C(C/N=C/c1c(O)n(Cc2ccc(OC)cc2)c(=O)c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C30H33N3O3/c1-4-32(5-2)28(23-11-7-6-8-12-23)20-31-19-27-25-13-9-10-14-26(25)29(34)33(30(27)35)21-22-15-17-24(36-3)18-16-22/h6-19,28,35H,4-5,20-21H2,1-3H3/b31-19+ |
| InChIKey | HEYPYEIUKFJVCI-ZCTHSVRISA-N |
| XLogP | 5.27 |
| TPSA | 67.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|